CAS 1342699-47-1 is the registry number for 4-(2-Bromophenyl)-5-isoxazolamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-bromophenyl)-1,2-oxazol-5-amine (CAS 1342699-47-1) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 4-(2-bromophenyl)-1,2-oxazol-5-amine. InChIKey: DNNZLGNUECLELG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 4-(2-bromophenyl)-1,2-oxazol-5-amine |
| InChIKey | DNNZLGNUECLELG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(ON=C2)N)Br |
Computed by PubChem (NCBI)