Products 1343463-05-7
CAS 1343463-05-7 is the registry number for 4-(3-Chlorophenyl)-4-methylpiperidine-2,6-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(3-chlorophenyl)-4-methylpiperidine-2,6-dione (CAS 1343463-05-7) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 4-(3-chlorophenyl)-4-methylpiperidine-2,6-dione. InChIKey: ZHNWSXXHTPOJHC-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-4-methylpiperidine-2,6-dione |
| InChIKey | ZHNWSXXHTPOJHC-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC(=O)C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)