CAS 1343656-29-0 appears in our catalog under these names: 3-Amino-1-(2,4-dichlorophenyl)piperidin-2-one, 95%, 3-Amino-1-(2,4-dichlorophenyl)piperidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-amino-1-(2,4-dichlorophenyl)piperidin-2-one (CAS 1343656-29-0) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: 3-amino-1-(2,4-dichlorophenyl)piperidin-2-one. InChIKey: UMCVLBNRWIHJCL-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 3-amino-1-(2,4-dichlorophenyl)piperidin-2-one |
| InChIKey | UMCVLBNRWIHJCL-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=C(C=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)