CAS 134677-59-1 is the registry number for Endo-3-cbz-3-azabicyclo[3.1.0]hexane-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(1R,5S)-3-phenylmethoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (CAS 134677-59-1) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (1R,5S)-3-phenylmethoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid. InChIKey: ICSLZBSYUJAPNS-FOSCPWQOSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (1R,5S)-3-phenylmethoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| InChIKey | ICSLZBSYUJAPNS-FOSCPWQOSA-N |
| SMILES | C1[C@@H]2[C@@H](C2C(=O)O)CN1C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)