Products 1345860-71-0
CAS 1345860-71-0 is the registry number for N-Phenyl-4-(4-phenyl-1-naphthalenyl)benzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-phenyl-4-(4-phenylnaphthalen-1-yl)aniline (CAS 1345860-71-0) is a chemical compound with the molecular formula C28H21N and a molecular weight of 371.5 g/mol. IUPAC name: N-phenyl-4-(4-phenylnaphthalen-1-yl)aniline. InChIKey: RBKCFIFXDFZHHA-UHFFFAOYSA-N.
| Molecular formula | C28H21N |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | N-phenyl-4-(4-phenylnaphthalen-1-yl)aniline |
| InChIKey | RBKCFIFXDFZHHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C3=CC=CC=C32)C4=CC=C(C=C4)NC5=CC=CC=C5 |
Computed by PubChem (NCBI)