Products 1609104-34-8
CAS 1609104-34-8 is the registry number for 2-(4-(1,2,2-Triphenylvinyl)phenyl)acetonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(1,2,2-triphenylethenyl)phenyl]acetonitrile (CAS 1609104-34-8) is a chemical compound with the molecular formula C28H21N and a molecular weight of 371.5 g/mol. IUPAC name: 2-[4-(1,2,2-triphenylethenyl)phenyl]acetonitrile. InChIKey: MMHMFDOASTUCEB-UHFFFAOYSA-N.
| Molecular formula | C28H21N |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 2-[4-(1,2,2-triphenylethenyl)phenyl]acetonitrile |
| InChIKey | MMHMFDOASTUCEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)CC#N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)