CAS 1446448-96-9 is the registry number for N-[4-(1-Naphthalenyl)phenyl][1,1′-biphenyl]-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
N-(4-naphthalen-1-ylphenyl)-3-phenylaniline (CAS 1446448-96-9) is a chemical compound with the molecular formula C28H21N and a molecular weight of 371.5 g/mol. IUPAC name: N-(4-naphthalen-1-ylphenyl)-3-phenylaniline. InChIKey: VNKRRCUSUXAKEZ-UHFFFAOYSA-N.
| Molecular formula | C28H21N |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | N-(4-naphthalen-1-ylphenyl)-3-phenylaniline |
| InChIKey | VNKRRCUSUXAKEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=CC=C(C=C3)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)