CAS 2893792-86-2 is the registry number for 5-(Naphthalen-1-yl)-N-phenyl-[1,1'-biphenyl]-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-naphthalen-1-yl-N,2-diphenylaniline (CAS 2893792-86-2) is a chemical compound with the molecular formula C28H21N and a molecular weight of 371.5 g/mol. IUPAC name: 4-naphthalen-1-yl-N,2-diphenylaniline. InChIKey: YHIOMEDTALCADA-UHFFFAOYSA-N.
| Molecular formula | C28H21N |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 4-naphthalen-1-yl-N,2-diphenylaniline |
| InChIKey | YHIOMEDTALCADA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)C3=CC=CC4=CC=CC=C43)NC5=CC=CC=C5 |
Computed by PubChem (NCBI)