CAS 3263-79-4 is the registry number for 2,3,4,5-Tetraphenyl-1H-pyrrole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,4,5-tetraphenyl-1H-pyrrole (CAS 3263-79-4) is a chemical compound with the molecular formula C28H21N and a molecular weight of 371.5 g/mol. IUPAC name: 2,3,4,5-tetraphenyl-1H-pyrrole. InChIKey: IEZVMRGFNUNABR-UHFFFAOYSA-N.
| Molecular formula | C28H21N |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 2,3,4,5-tetraphenyl-1H-pyrrole |
| InChIKey | IEZVMRGFNUNABR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)