CAS 897921-60-7 is the registry number for N–(4–(Naphthalen–2–yl)phenyl)–(1,1'–biphenyl)–4–amine. Offered by: GLPBio. Available pack sizes: 1g.
N-(4-naphthalen-2-ylphenyl)-4-phenylaniline (CAS 897921-60-7) is a chemical compound with the molecular formula C28H21N and a molecular weight of 371.5 g/mol. IUPAC name: N-(4-naphthalen-2-ylphenyl)-4-phenylaniline. InChIKey: SJXDKVIQCRMTOS-UHFFFAOYSA-N.
| Molecular formula | C28H21N |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | N-(4-naphthalen-2-ylphenyl)-4-phenylaniline |
| InChIKey | SJXDKVIQCRMTOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)