Products 897671-77-1
CAS 897671-77-1 is the registry number for 4-[1,1′-Biphenyl]-4-yl-N-phenyl-1-naphthalenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-phenyl-4-(4-phenylphenyl)naphthalen-1-amine (CAS 897671-77-1) is a chemical compound with the molecular formula C28H21N and a molecular weight of 371.5 g/mol. IUPAC name: N-phenyl-4-(4-phenylphenyl)naphthalen-1-amine. InChIKey: XGGDIPWRHUJDBT-UHFFFAOYSA-N.
| Molecular formula | C28H21N |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | N-phenyl-4-(4-phenylphenyl)naphthalen-1-amine |
| InChIKey | XGGDIPWRHUJDBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C4=CC=CC=C43)NC5=CC=CC=C5 |
Computed by PubChem (NCBI)