Products 1346599-41-4
CAS 1346599-41-4 is the registry number for Etilefrin-D5 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg.
3-[1-hydroxy-2-(1,1,2,2,2-pentadeuterioethylamino)ethyl]phenol;hydrochloride (CAS 1346599-41-4) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 222.72 g/mol. IUPAC name: 3-[1-hydroxy-2-(1,1,2,2,2-pentadeuterioethylamino)ethyl]phenol;hydrochloride. InChIKey: KTNROWWHOBZQGK-LUIAAVAXSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 222.72 g/mol |
| IUPAC name | 3-[1-hydroxy-2-(1,1,2,2,2-pentadeuterioethylamino)ethyl]phenol;hydrochloride |
| InChIKey | KTNROWWHOBZQGK-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NCC(C1=CC(=CC=C1)O)O.Cl |
Computed by PubChem (NCBI)