Products 1346600-36-9
CAS 1346600-36-9 is the registry number for 5-Chloro-2-methoxy-benzoic Acid-13C,d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
5-chloro-2-(trideuterio(113C)methoxy)benzoic acid (CAS 1346600-36-9) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 190.60 g/mol. IUPAC name: 5-chloro-2-(trideuterio(113C)methoxy)benzoic acid. InChIKey: HULDRQRKKXRXBI-KQORAOOSSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 190.60 g/mol |
| IUPAC name | 5-chloro-2-(trideuterio(113C)methoxy)benzoic acid |
| InChIKey | HULDRQRKKXRXBI-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=C(C=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)