Products 1346601-36-2

CAS 1346601-36-2 is the registry number for 4-(Methylamino)-3-nitrobenzoic-d3 Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

3-nitro-4-(trideuteriomethylamino)benzoic acid (CAS 1346601-36-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 199.18 g/mol. IUPAC name: 3-nitro-4-(trideuteriomethylamino)benzoic acid. InChIKey: KSMLIIWEQBYUKA-FIBGUPNXSA-N.

Identity
Molecular formulaC8H8N2O4
Molecular weight199.18 g/mol
IUPAC name3-nitro-4-(trideuteriomethylamino)benzoic acid
InChIKeyKSMLIIWEQBYUKA-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])NC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)