CAS 1346601-36-2 is the registry number for 4-(Methylamino)-3-nitrobenzoic-d3 Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.
3-nitro-4-(trideuteriomethylamino)benzoic acid (CAS 1346601-36-2) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 199.18 g/mol. IUPAC name: 3-nitro-4-(trideuteriomethylamino)benzoic acid. InChIKey: KSMLIIWEQBYUKA-FIBGUPNXSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 3-nitro-4-(trideuteriomethylamino)benzoic acid |
| InChIKey | KSMLIIWEQBYUKA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)