CAS 1346602-08-1 is the registry number for 4-Nitro-4’-acetylaminodiphenyl-d4 Sulfone. Offered by: TRC. Available pack sizes: 10mg, 1mg.
N-[2,3,5,6-tetradeuterio-4-(4-nitrophenyl)sulfonylphenyl]acetamide (CAS 1346602-08-1) is a chemical compound with the molecular formula C14H12N2O5S and a molecular weight of 324.35 g/mol. IUPAC name: N-[2,3,5,6-tetradeuterio-4-(4-nitrophenyl)sulfonylphenyl]acetamide. InChIKey: YRZGYZAAOZVGMI-USSMZTJJSA-N.
| Molecular formula | C14H12N2O5S |
|---|---|
| Molecular weight | 324.35 g/mol |
| IUPAC name | N-[2,3,5,6-tetradeuterio-4-(4-nitrophenyl)sulfonylphenyl]acetamide |
| InChIKey | YRZGYZAAOZVGMI-USSMZTJJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)