CAS 1775-37-7 appears in our catalog under these names: 4-Nitro-4'-acetylaminodiphenyl sulfone, 95%, 4-Nitro-4’-acetylaminodiphenyl Sulfone, 4-Nitro-4'-acetylaminodiphenyl sulfone. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg, 1000mg, 2000mg, 5000mg.
N-[4-(4-nitrophenyl)sulfonylphenyl]acetamide (CAS 1775-37-7) is a chemical compound with the molecular formula C14H12N2O5S and a molecular weight of 320.32 g/mol. IUPAC name: N-[4-(4-nitrophenyl)sulfonylphenyl]acetamide. InChIKey: YRZGYZAAOZVGMI-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5S |
|---|---|
| Molecular weight | 320.32 g/mol |
| IUPAC name | N-[4-(4-nitrophenyl)sulfonylphenyl]acetamide |
| InChIKey | YRZGYZAAOZVGMI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)