CAS 36965-14-7 is the registry number for 4-Nitro-N-(4-methylbenzenesulfonyl)benzenecarboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.
N-(4-methylphenyl)sulfonyl-4-nitrobenzamide (CAS 36965-14-7) is a chemical compound with the molecular formula C14H12N2O5S and a molecular weight of 320.32 g/mol. IUPAC name: N-(4-methylphenyl)sulfonyl-4-nitrobenzamide. InChIKey: RDMLZRJANJOXFB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5S |
|---|---|
| Molecular weight | 320.32 g/mol |
| IUPAC name | N-(4-methylphenyl)sulfonyl-4-nitrobenzamide |
| InChIKey | RDMLZRJANJOXFB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)