CAS 676246-99-4 is the registry number for 4–(3,4–Dimethyl–6–oxopyrano(2,3–c)pyrazol–1(6H)–yl)benzenesulfonic acid. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
4-(3,4-dimethyl-6-oxopyrano[3,2-d]pyrazol-1-yl)benzenesulfonic acid (CAS 676246-99-4) is a chemical compound with the molecular formula C14H12N2O5S and a molecular weight of 320.32 g/mol. IUPAC name: 4-(3,4-dimethyl-6-oxopyrano[3,2-d]pyrazol-1-yl)benzenesulfonic acid. InChIKey: GADUUVISAXGZBM-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5S |
|---|---|
| Molecular weight | 320.32 g/mol |
| IUPAC name | 4-(3,4-dimethyl-6-oxopyrano[3,2-d]pyrazol-1-yl)benzenesulfonic acid |
| InChIKey | GADUUVISAXGZBM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C(=NN2C3=CC=C(C=C3)S(=O)(=O)O)C |
Computed by PubChem (NCBI)