Products 801224-73-7
CAS 801224-73-7 appears in our catalog under these names: 2-[(1-methyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]acetic acid, 97%, 97%, 2-[(1-methyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]acetic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 100mg.
2-[(1-methyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]acetic acid (CAS 801224-73-7) is a chemical compound with the molecular formula C14H12N2O5S and a molecular weight of 320.32 g/mol. IUPAC name: 2-[(1-methyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]acetic acid. InChIKey: GTYJVHSLFRFPEL-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O5S |
|---|---|
| Molecular weight | 320.32 g/mol |
| IUPAC name | 2-[(1-methyl-2-oxobenzo[cd]indol-6-yl)sulfonylamino]acetic acid |
| InChIKey | GTYJVHSLFRFPEL-UHFFFAOYSA-N |
| SMILES | CN1C2=C3C(=C(C=C2)S(=O)(=O)NCC(=O)O)C=CC=C3C1=O |
Computed by PubChem (NCBI)