Products 6955-49-3

CAS 6955-49-3 is the registry number for 2-((4-Sulfamoylphenyl)carbamoyl)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(4-sulfamoylphenyl)carbamoyl]benzoic acid (CAS 6955-49-3) is a chemical compound with the molecular formula C14H12N2O5S and a molecular weight of 320.32 g/mol. IUPAC name: 2-[(4-sulfamoylphenyl)carbamoyl]benzoic acid. InChIKey: IYDVPRRWOHHTSF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N2O5S
Molecular weight320.32 g/mol
IUPAC name2-[(4-sulfamoylphenyl)carbamoyl]benzoic acid
InChIKeyIYDVPRRWOHHTSF-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)