CAS 1346602-12-7 appears in our catalog under these names: Dapsone-d4, >95% (HPLC), Dapsone-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
4-(4-aminophenyl)sulfonyl-2,3,5,6-tetradeuterioaniline (CAS 1346602-12-7) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 252.33 g/mol. IUPAC name: 4-(4-aminophenyl)sulfonyl-2,3,5,6-tetradeuterioaniline. InChIKey: MQJKPEGWNLWLTK-NMRLXUNGSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 252.33 g/mol |
| IUPAC name | 4-(4-aminophenyl)sulfonyl-2,3,5,6-tetradeuterioaniline |
| InChIKey | MQJKPEGWNLWLTK-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)C2=CC=C(C=C2)N)[2H] |
Computed by PubChem (NCBI)