CAS 557794-38-4 appears in our catalog under these names: Dapsone-d8, Dapsone-D8 (major), Dapsone–d8, Dapsone-d8, 99.82%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 5 mg, 10 mg, 1 mg.
4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonyl-2,3,5,6-tetradeuterioaniline (CAS 557794-38-4) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 256.35 g/mol. IUPAC name: 4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonyl-2,3,5,6-tetradeuterioaniline. InChIKey: MQJKPEGWNLWLTK-PGRXLJNUSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 256.35 g/mol |
| IUPAC name | 4-(4-amino-2,3,5,6-tetradeuteriophenyl)sulfonyl-2,3,5,6-tetradeuterioaniline |
| InChIKey | MQJKPEGWNLWLTK-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)C2=C(C(=C(C(=C2[2H])[2H])N)[2H])[2H])[2H] |
Computed by PubChem (NCBI)