Products 287476-19-1
CAS 287476-19-1 is the registry number for Dapsone-15N2. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, Get quote.
4-(4-(15N)azanylphenyl)sulfonyl(15N2)aniline (CAS 287476-19-1) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 250.29 g/mol. IUPAC name: 4-(4-(15N)azanylphenyl)sulfonyl(15N2)aniline. InChIKey: MQJKPEGWNLWLTK-SBAVNFSASA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 4-(4-(15N)azanylphenyl)sulfonyl(15N2)aniline |
| InChIKey | MQJKPEGWNLWLTK-SBAVNFSASA-N |
| SMILES | C1=CC(=CC=C1[15NH2])S(=O)(=O)C2=CC=C(C=C2)[15NH2] |
Computed by PubChem (NCBI)