Products 1346603-27-7
CAS 1346603-27-7 appears in our catalog under these names: Secnidazole-d6, >95% (HPLC), Secnidazole-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
1,1,1,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (CAS 1346603-27-7) is a chemical compound with the molecular formula C7H11N3O3 and a molecular weight of 191.22 g/mol. IUPAC name: 1,1,1,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol. InChIKey: KPQZUUQMTUIKBP-KUMAEYKDSA-N.
| Molecular formula | C7H11N3O3 |
|---|---|
| Molecular weight | 191.22 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| InChIKey | KPQZUUQMTUIKBP-KUMAEYKDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])N1C(=NC=C1[N+](=O)[O-])C)O |
Computed by PubChem (NCBI)