Products 1346604-10-1
CAS 1346604-10-1 appears in our catalog under these names: rac N-(Acetyl-d3) Ephedrine, rac N-Acetyl Ephedrine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
2,2,2-trideuterio-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (CAS 1346604-10-1) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 210.29 g/mol. IUPAC name: 2,2,2-trideuterio-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide. InChIKey: ZZGMTCKULVMTDB-GURFDWSASA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| InChIKey | ZZGMTCKULVMTDB-GURFDWSASA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N(C)[C@H](C)[C@H](C1=CC=CC=C1)O |
Computed by PubChem (NCBI)