CAS 5661-42-7 is the registry number for rac N-Acetyl Ephedrine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (CAS 5661-42-7) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide. InChIKey: ZZGMTCKULVMTDB-BXKDBHETSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| InChIKey | ZZGMTCKULVMTDB-BXKDBHETSA-N |
| SMILES | C[C@H]([C@H](C1=CC=CC=C1)O)N(C)C(=O)C |
Computed by PubChem (NCBI)