Products 894793-15-8
CAS 894793-15-8 appears in our catalog under these names: (1S,2R)-N-Acetyl Ephedrine, (1S,2R)-N-Acetyl Ephedrine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
N-[(2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (CAS 894793-15-8) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: N-[(2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide. InChIKey: ZZGMTCKULVMTDB-PKEIRNPWSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-[(2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| InChIKey | ZZGMTCKULVMTDB-PKEIRNPWSA-N |
| SMILES | C[C@H](C(C1=CC=CC=C1)O)N(C)C(=O)C |
Computed by PubChem (NCBI)