CAS 84472-25-3 appears in our catalog under these names: N-Acetyl-(+)-Pseudoephedrine, >95% (HPLC), (1S,2S)-N-Acetylpseudoephedrine. Offered by: TRC, Mikromol. Available pack sizes: 100mg, 25mg.
N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (CAS 84472-25-3) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide. InChIKey: ZZGMTCKULVMTDB-JOYOIKCWSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| InChIKey | ZZGMTCKULVMTDB-JOYOIKCWSA-N |
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1)O)N(C)C(=O)C |
Computed by PubChem (NCBI)