CAS 2272-83-5 is the registry number for N-Acetyl Ephedrine. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide (CAS 2272-83-5) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide. InChIKey: ZZGMTCKULVMTDB-CABZTGNLSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylacetamide |
| InChIKey | ZZGMTCKULVMTDB-CABZTGNLSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)O)N(C)C(=O)C |
Computed by PubChem (NCBI)