Products 1346604-84-9
CAS 1346604-84-9 is the registry number for cis,trans-(1,1-Dimethylethoxy)carbonyl Tranexamic Acid-13C2,15N. Offered by: TRC. Available pack sizes: 10mg, 1mg.
4-[[(2-methylpropan-2-yl)oxycarbonyl(15N)amino](113C)methyl]cyclohexane-1-carboxylic acid (CAS 1346604-84-9) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 260.30 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonyl(15N)amino](113C)methyl]cyclohexane-1-carboxylic acid. InChIKey: AZEKNJGFCSHZID-FXNVFEFKSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 260.30 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonyl(15N)amino](113C)methyl]cyclohexane-1-carboxylic acid |
| InChIKey | AZEKNJGFCSHZID-FXNVFEFKSA-N |
| SMILES | CC(C)(C)OC(=O)[15NH][13CH2]C1CCC(CC1)[13C](=O)O |
Computed by PubChem (NCBI)