CAS 27687-14-5 appears in our catalog under these names: Boc-tranexamic acid, 97%, trans–4–(tert–Butoxycarbonylaminomethyl)cyclohexanecarboxylic Acid, Boc-4-AMCHC-OH, BOC-Tranexamic acid, trans-4-(tert-Butoxycarbonylaminomethyl)cyclohexanecarboxylic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 50g, 10g, 500g, 1kg.
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid (CAS 27687-14-5) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid. InChIKey: AZEKNJGFCSHZID-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | AZEKNJGFCSHZID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)