CAS 1346669-48-4 appears in our catalog under these names: 9-([1,1'-Biphenyl]-4-yl)-9H,9'H-3,3'-bicarbazole 98%, 9-([1,1'-Biphenyl]-4-yl)-9H,9'H-3,3'-bicarbazole, 98%, 98%, 9-[1,1'-biphenyl]-4-yl-3,3'-Bi-9H-carbazole, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3-(9H-carbazol-3-yl)-9-(4-phenylphenyl)carbazole (CAS 1346669-48-4) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 3-(9H-carbazol-3-yl)-9-(4-phenylphenyl)carbazole. InChIKey: PWZMFRJQQYRBTQ-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 3-(9H-carbazol-3-yl)-9-(4-phenylphenyl)carbazole |
| InChIKey | PWZMFRJQQYRBTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=C(C=C(C=C4)C5=CC6=C(C=C5)NC7=CC=CC=C76)C8=CC=CC=C83 |
Computed by PubChem (NCBI)