CAS 1363543-83-2 appears in our catalog under these names: 3,8–Di((1,1'–biphenyl)–4–yl)–1,10–phenanthroline, 3,8-Di([1,1'-biphenyl]-4-yl)-1,10-phenanthroline, 95%, 95%, 3,8-Di([1,1'-biphenyl]-4-yl)-1,10-phenanthroline, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
3,8-bis(4-phenylphenyl)-1,10-phenanthroline (CAS 1363543-83-2) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 3,8-bis(4-phenylphenyl)-1,10-phenanthroline. InChIKey: OWBSVQOUBMENBM-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 3,8-bis(4-phenylphenyl)-1,10-phenanthroline |
| InChIKey | OWBSVQOUBMENBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CN=C4C(=C3)C=CC5=CC(=CN=C54)C6=CC=C(C=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)