CAS 917867-92-6 is the registry number for 2,2'-Diphenyl-9H,9'H-3,3'-bicarbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenyl-3-(2-phenyl-9H-carbazol-3-yl)-9H-carbazole (CAS 917867-92-6) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 2-phenyl-3-(2-phenyl-9H-carbazol-3-yl)-9H-carbazole. InChIKey: NHXXSZFFFKIYFP-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 2-phenyl-3-(2-phenyl-9H-carbazol-3-yl)-9H-carbazole |
| InChIKey | NHXXSZFFFKIYFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C3C4=CC=CC=C4NC3=C2)C5=C(C=C6C(=C5)C7=CC=CC=C7N6)C8=CC=CC=C8 |
Computed by PubChem (NCBI)