CAS 51786-73-3 is the registry number for 2,4,7,9-Tetraphenyl-1,10-phenanthroline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,7,9-tetraphenyl-1,10-phenanthroline (CAS 51786-73-3) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 2,4,7,9-tetraphenyl-1,10-phenanthroline. InChIKey: KTSGGWMVDAECFK-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 2,4,7,9-tetraphenyl-1,10-phenanthroline |
| InChIKey | KTSGGWMVDAECFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=C2C=CC4=C3N=C(C=C4C5=CC=CC=C5)C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)