CAS 96710-07-5 appears in our catalog under these names: 4,7–Di((1,1'–biphenyl)–4–yl)–1,10–phenanthroline, 4,7-Di([1,1'-biphenyl]-4-yl)-1,10-phenanthroline, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4,7-bis(4-phenylphenyl)-1,10-phenanthroline (CAS 96710-07-5) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 4,7-bis(4-phenylphenyl)-1,10-phenanthroline. InChIKey: PPDYSQZUNLCLKO-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 4,7-bis(4-phenylphenyl)-1,10-phenanthroline |
| InChIKey | PPDYSQZUNLCLKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=C4C=CC5=C(C=CN=C5C4=NC=C3)C6=CC=C(C=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)