CAS 750573-28-5 is the registry number for Poly(9,9-di-(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with 2,5-diphenyl-1,2,4-oxadiazole. Offered by: Lumtec. Available pack sizes: On request.
9-(3-carbazol-9-yl-5-phenylphenyl)carbazole (CAS 750573-28-5) is a chemical compound with the molecular formula C36H24N2 and a molecular weight of 484.6 g/mol. IUPAC name: 9-(3-carbazol-9-yl-5-phenylphenyl)carbazole. InChIKey: CVXXPNSMZIRFAA-UHFFFAOYSA-N.
| Molecular formula | C36H24N2 |
|---|---|
| Molecular weight | 484.6 g/mol |
| IUPAC name | 9-(3-carbazol-9-yl-5-phenylphenyl)carbazole |
| InChIKey | CVXXPNSMZIRFAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)N3C4=CC=CC=C4C5=CC=CC=C53)N6C7=CC=CC=C7C8=CC=CC=C86 |
Computed by PubChem (NCBI)