CAS 1346679-11-5 appears in our catalog under these names: 4,5-Dichloro-2-iodobenzoic acid, 97%, 97%, 4,5-Dichloro-2-iodobenzoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4,5-dichloro-2-iodobenzoic acid (CAS 1346679-11-5) is a chemical compound with the molecular formula C7H3Cl2IO2 and a molecular weight of 316.90 g/mol. IUPAC name: 4,5-dichloro-2-iodobenzoic acid. InChIKey: GGNMKQUAUXWAMF-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO2 |
|---|---|
| Molecular weight | 316.90 g/mol |
| IUPAC name | 4,5-dichloro-2-iodobenzoic acid |
| InChIKey | GGNMKQUAUXWAMF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)I)C(=O)O |
Computed by PubChem (NCBI)