CAS 15396-37-9 appears in our catalog under these names: 3,5-Dichloro-2-iodobenzoic acid, 97%, 3,5-Dichloro-2-iodobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3,5-dichloro-2-iodobenzoic acid (CAS 15396-37-9) is a chemical compound with the molecular formula C7H3Cl2IO2 and a molecular weight of 316.90 g/mol. IUPAC name: 3,5-dichloro-2-iodobenzoic acid. InChIKey: DJTJHMZDOREVFA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO2 |
|---|---|
| Molecular weight | 316.90 g/mol |
| IUPAC name | 3,5-dichloro-2-iodobenzoic acid |
| InChIKey | DJTJHMZDOREVFA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)I)Cl)Cl |
Computed by PubChem (NCBI)