Products 219841-88-0
CAS 219841-88-0 is the registry number for 2,3-Dichloro-6-iodobenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,3-dichloro-6-iodobenzoic acid (CAS 219841-88-0) is a chemical compound with the molecular formula C7H3Cl2IO2 and a molecular weight of 316.90 g/mol. IUPAC name: 2,3-dichloro-6-iodobenzoic acid. InChIKey: ZQJAAHWFOYUIBV-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO2 |
|---|---|
| Molecular weight | 316.90 g/mol |
| IUPAC name | 2,3-dichloro-6-iodobenzoic acid |
| InChIKey | ZQJAAHWFOYUIBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)C(=O)O)I |
Computed by PubChem (NCBI)