Products 1507268-55-4
CAS 1507268-55-4 appears in our catalog under these names: 3,4-Dichloro-5-iodobenzoic acid, 95%, 3,4-Dichloro-5-iodobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,4-dichloro-5-iodobenzoic acid (CAS 1507268-55-4) is a chemical compound with the molecular formula C7H3Cl2IO2 and a molecular weight of 316.90 g/mol. IUPAC name: 3,4-dichloro-5-iodobenzoic acid. InChIKey: YGUKCONYJCPJTI-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO2 |
|---|---|
| Molecular weight | 316.90 g/mol |
| IUPAC name | 3,4-dichloro-5-iodobenzoic acid |
| InChIKey | YGUKCONYJCPJTI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)I)C(=O)O |
Computed by PubChem (NCBI)