CAS 959762-87-9 appears in our catalog under these names: 2,4-Dichloro-5-iodobenzoic acid, 95%, 2,4-Dichloro-5-iodobenzoic acid. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 0,5g.
2,4-dichloro-5-iodobenzoic acid (CAS 959762-87-9) is a chemical compound with the molecular formula C7H3Cl2IO2 and a molecular weight of 316.90 g/mol. IUPAC name: 2,4-dichloro-5-iodobenzoic acid. InChIKey: RVEQDEIBFPXXBJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO2 |
|---|---|
| Molecular weight | 316.90 g/mol |
| IUPAC name | 2,4-dichloro-5-iodobenzoic acid |
| InChIKey | RVEQDEIBFPXXBJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)