Products 42860-07-1
CAS 42860-07-1 is the registry number for 2,5-Dichloro-3-iodobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-dichloro-3-iodobenzoic acid (CAS 42860-07-1) is a chemical compound with the molecular formula C7H3Cl2IO2 and a molecular weight of 316.90 g/mol. IUPAC name: 2,5-dichloro-3-iodobenzoic acid. InChIKey: XCQUUGTVVMRAFS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2IO2 |
|---|---|
| Molecular weight | 316.90 g/mol |
| IUPAC name | 2,5-dichloro-3-iodobenzoic acid |
| InChIKey | XCQUUGTVVMRAFS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)I)Cl |
Computed by PubChem (NCBI)