CAS 13471-68-6 appears in our catalog under these names: 2-Methyl-5-nitrophenyl isocyanate, 97%, 2-Methyl-5-Nitrophenylisocyanate, 99%(GC-MS),RG, 99%(GC-MS),RG, 2-Methyl-5-nitrophenyl isocyanate, 99%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
2-isocyanato-1-methyl-4-nitrobenzene (CAS 13471-68-6) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-isocyanato-1-methyl-4-nitrobenzene. InChIKey: PQFOUIMVTGBFRN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-isocyanato-1-methyl-4-nitrobenzene |
| InChIKey | PQFOUIMVTGBFRN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])N=C=O |
Computed by PubChem (NCBI)