Products 1347130-57-7
CAS 1347130-57-7 is the registry number for 5-((tert-Butoxycarbonyl)amino)-1H-pyrazole-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid (CAS 1347130-57-7) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid. InChIKey: WUTZIUVAELZUJK-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrazole-5-carboxylic acid |
| InChIKey | WUTZIUVAELZUJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NNC(=C1)C(=O)O |
Computed by PubChem (NCBI)