Products 134755-34-3
CAS 134755-34-3 is the registry number for 4-(2-Aminoethyl)-2,6-dibromophenol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-aminoethyl)-2,6-dibromophenol (CAS 134755-34-3) is a chemical compound with the molecular formula C8H9Br2NO and a molecular weight of 294.97 g/mol. IUPAC name: 4-(2-aminoethyl)-2,6-dibromophenol. InChIKey: WRFLDHTYCUHHFK-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO |
|---|---|
| Molecular weight | 294.97 g/mol |
| IUPAC name | 4-(2-aminoethyl)-2,6-dibromophenol |
| InChIKey | WRFLDHTYCUHHFK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)CCN |
Computed by PubChem (NCBI)