Products 15473-81-1
CAS 15473-81-1 is the registry number for 1-(3-Aminophenyl)-2-bromoethan-1-one hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-aminophenyl)-2-bromoethanone;hydrobromide (CAS 15473-81-1) is a chemical compound with the molecular formula C8H9Br2NO and a molecular weight of 294.97 g/mol. IUPAC name: 1-(3-aminophenyl)-2-bromoethanone;hydrobromide. InChIKey: PGBARHRJKVWGFH-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO |
|---|---|
| Molecular weight | 294.97 g/mol |
| IUPAC name | 1-(3-aminophenyl)-2-bromoethanone;hydrobromide |
| InChIKey | PGBARHRJKVWGFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)CBr.Br |
Computed by PubChem (NCBI)