CAS 147097-80-1 is the registry number for 2-Bromo-1-(6-methylpyridin-2-yl)ethanone hydrobromide, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-bromo-1-(6-methyl-2-pyridinyl)ethanone;hydrobromide (CAS 147097-80-1) is a chemical compound with the molecular formula C8H9Br2NO and a molecular weight of 294.97 g/mol. IUPAC name: 2-bromo-1-(6-methyl-2-pyridinyl)ethanone;hydrobromide. InChIKey: DBFKIBLPKPKSLU-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO |
|---|---|
| Molecular weight | 294.97 g/mol |
| IUPAC name | 2-bromo-1-(6-methyl-2-pyridinyl)ethanone;hydrobromide |
| InChIKey | DBFKIBLPKPKSLU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C(=O)CBr.Br |
Computed by PubChem (NCBI)