CAS 435273-53-3 is the registry number for 2-Bromo-1-(4-methylpyridin-3-yl)ethan-1-one hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-1-(4-methyl-3-pyridinyl)ethanone;hydrobromide (CAS 435273-53-3) is a chemical compound with the molecular formula C8H9Br2NO and a molecular weight of 294.97 g/mol. IUPAC name: 2-bromo-1-(4-methyl-3-pyridinyl)ethanone;hydrobromide. InChIKey: OVQVUSADZFZNNS-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO |
|---|---|
| Molecular weight | 294.97 g/mol |
| IUPAC name | 2-bromo-1-(4-methyl-3-pyridinyl)ethanone;hydrobromide |
| InChIKey | OVQVUSADZFZNNS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1)C(=O)CBr.Br |
Computed by PubChem (NCBI)