CAS 67279-27-0 appears in our catalog under these names: 2-Bromo-1-(2-methylpyridin-3-yl)ethan-1-one hydrobromide, 95%, 2-Bromo-1-(2-methylpyridin-3-yl)ethan-1-one hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-bromo-1-(2-methyl-3-pyridinyl)ethanone;hydrobromide (CAS 67279-27-0) is a chemical compound with the molecular formula C8H9Br2NO and a molecular weight of 294.97 g/mol. IUPAC name: 2-bromo-1-(2-methyl-3-pyridinyl)ethanone;hydrobromide. InChIKey: QWQWBFDKASRNBJ-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO |
|---|---|
| Molecular weight | 294.97 g/mol |
| IUPAC name | 2-bromo-1-(2-methyl-3-pyridinyl)ethanone;hydrobromide |
| InChIKey | QWQWBFDKASRNBJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=N1)C(=O)CBr.Br |
Computed by PubChem (NCBI)